The Benzene,1,4-bis(bromomethyl)-2,3,5,6-tetramethyl-, with the CAS registry number 35168-64-0, is also known as 3,6-Bis(bromomethyl)durene. Its EINECS number is 252-414-8. This chemical's molecular formula is C₁₂H₁₆Br₂ and molecular weight is 320.06. What's more, its IUPAC name is 1,4-bis(bromomethyl)-2,3,5,6-tetramethylbenzene.

Physical properties of Benzene,1,4-bis(bromomethyl)-2,3,5,6-tetramethyl- are: (1)ACD/LogP: 5.46; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.46; (4)ACD/LogD (pH 7.4): 5.46; (5)ACD/BCF (pH 5.5): 8311.03; (6)ACD/BCF (pH 7.4): 8311.03; (7)ACD/KOC (pH 5.5): 22247.39; (8)ACD/KOC (pH 7.4): 22247.39; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 0 Å²; (13)Index of Refraction: 1.577; (14)Molar Refractivity: 70.84 cm³; (15)Molar Volume: 213.5 cm³; (16)Polarizability: 28.08×10^-24cm³; (17)Surface Tension: 39.6 dyne/cm; (18)Density: 1.498 g/cm³; (19)Flash Point: 195.2 °C; (20)Enthalpy of Vaporization: 57.47 kJ/mol; (21)Boiling Point: 353.3 °C at 760 mmHg; (22)Vapour Pressure: 7.35E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: BrCc1c(c(c(c(c1C)C)CBr)C)C
(2)Std. InChI: InChI=1S/C12H16Br2/c1-7-8(2)12(6-14)10(4)9(3)11(7)5-13/h5-6H2,1-4H3
(3)Std. InChIKey: OREPDRBSWICSCF-UHFFFAOYSA-N