The Benzene,1-butyl-4-ethenyl-, with the CAS registry number 26206-42-8, is also known as 4-Butylstyrene. This chemical's molecular formula is C₁₂H₁₆ and molecular weight is 160.2554. Its systematic name is called 1-butyl-4-ethenylbenzene.

Physical properties of Benzene,1-butyl-4-ethenyl-: (1)ACD/LogP: 4.89; (2)ACD/LogD (pH 5.5): 5; (3)ACD/LogD (pH 7.4): 5; (4)ACD/BCF (pH 5.5): 2415; (5)ACD/BCF (pH 7.4): 2415; (6)ACD/KOC (pH 5.5): 9185; (7)ACD/KOC (pH 7.4): 9185; (8)#Freely Rotating Bonds: 4; (9)Index of Refraction: 1.53; (10)Molar Refractivity: 55.992 cm³; (11)Molar Volume: 181.212 cm³; (12)Surface Tension: 31.237 dyne/cm; (13)Density: 0.884 g/cm³; (14)Flash Point: 88.796 °C; (15)Enthalpy of Vaporization: 45.067 kJ/mol; (16)Boiling Point: 233.042 °C at 760 mmHg; (17)Vapour Pressure: 0.087 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(ccc1CCCC)\C=C
(2)InChI: InChI=1/C12H16/c1-3-5-6-12-9-7-11(4-2)8-10-12/h4,7-10H,2-3,5-6H2,1H3
(3)InChIKey: QOVCUELHTLHMEN-UHFFFAOYAC