The Benzenemethanol,3-(5-methyl-1,2,4-oxadiazol-3-yl)- has the CAS registry number 852180-70-2. This chemical's molecular formula is C₁₀H₁₀N₂O₂ and molecular weight is 190.2. What's more, its systematic name is [3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methanol. 

Physical properties of Benzenemethanol,3-(5-methyl-1,2,4-oxadiazol-3-yl)- are: (1)ACD/LogP: 1.10; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.1; (4)ACD/LogD (pH 7.4): 1.1; (5)ACD/BCF (pH 5.5): 4.01; (6)ACD/BCF (pH 7.4): 4.01; (7)ACD/KOC (pH 5.5): 94.05; (8)ACD/KOC (pH 7.4): 94.05; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 48.15 Å²; (13)Index of Refraction: 1.57; (14)Molar Refractivity: 50.6 cm³; (15)Molar Volume: 154 cm³; (16)Polarizability: 20.06×10^-24cm³; (17)Surface Tension: 52.2 dyne/cm; (18)Density: 1.234 g/cm³; (19)Flash Point: 185.5 °C; (20)Enthalpy of Vaporization: 66.62 kJ/mol; (21)Boiling Point: 383.1 °C at 760 mmHg; (22)Vapour Pressure: 1.49E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: n1c(onc1c2cc(ccc2)CO)C
(2)InChI: InChI=1S/C10H10N2O2/c1-7-11-10(12-14-7)9-4-2-3-8(5-9)6-13/h2-5,13H,6H2,1H3
(3)InChIKey: KCLCEECIUZDIGI-UHFFFAOYSA-N