The CAS registry number of Benzenesulfonamide, 2-amino-5-methoxy- is 6451-50-9. Its molecular formula is C₇H₁₀N₂O₃S and molecular weight is 202.2309. Its systematic name is called 2-Amino-5-methoxy-benzene sulphonamide.

Physical properties about Benzenesulfonamide, 2-amino-5-methoxy- are: (1)ACD/LogP: 0.31; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.31; (4)ACD/LogD (pH 7.4): 0.31; (5)ACD/BCF (pH 5.5): 1.01; (6)ACD/BCF (pH 7.4): 1.01; (7)ACD/KOC (pH 5.5): 34.99; (8)ACD/KOC (pH 7.4): 34.96; (9)#H bond acceptors: 5; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 3; (12)Index of Refraction: 1.595; (13)Molar Refractivity: 49.17 cm³; (14)Molar Volume: 144.6 cm³; (15)Surface Tension: 58.2 dyne/cm; (16)Density: 1.397 g/cm³; (17)Flash Point: 216 °C; (18)Enthalpy of Vaporization: 68.95 kJ/mol; (19)Boiling Point: 433.6 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(c1c(ccc(OC)c1)N)N
(2)InChI: InChI=1/C7H10N2O3S/c1-12-5-2-3-6(8)7(4-5)13(9,10)11/h2-4H,8H2,1H3,(H2,9,10,11)
(3)InChIKey: DSUQOTGCKDGCEZ-UHFFFAOYAP