The CAS registry number of Benzenesulfonamide,3-amino-N,N-diethyl-4-methyl- is 17354-60-8. This chemical is also named as p-Toluenesulfonamide,3-amino-N,N-diethyl- (6CI,7CI). In addition, its molecular formula is C₁₁H₁₈N₂O₂S and molecular weight is 242.3378. Its systematic name and IUPAC name are the same which is called 3-amino-N,N-diethyl-4-methylbenzenesulfonamide.

Physical properties about Benzenesulfonamide,3-amino-N,N-diethyl-4-methyl- are: (1)ACD/LogP: 1.35; (2)#H bond acceptors: 4; (3)#H bond donors: 2; (4)#Freely Rotating Bonds: 5; (5)Index of Refraction: 1.554; (6)Molar Refractivity: 66.21 cm³; (7)Molar Volume: 206.5 cm³; (8)Surface Tension: 45.3 dyne/cm; (9)Density: 1.173 g/cm³; (10)Flash Point: 192.2 °C; (11)Enthalpy of Vaporization: 64.42 kJ/mol; (12)Boiling Point: 394.2 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(c1cc(N)c(cc1)C)N(CC)CC
(2)InChI: InChI=1/C11H18N2O2S/c1-4-13(5-2)16(14,15)10-7-6-9(3)11(12)8-10/h6-8H,4-5,12H2,1-3H3
(3)InChIKey: URPZZPGQCSFZLH-UHFFFAOYAO