The Benzo[h]cinnoline, with the CAS registry number 230-31-9, is also known as 5,6-Diazaphenanthrene. This chemical's molecular formula is C₁₂H₈N₂ and molecular weight is 180.2053. Its systematic name is called benzo[h]cinnoline.

Physical properties of Benzo[h]cinnoline: (1)ACD/LogP: 2.16; (2)ACD/LogD (pH 5.5): 2.16; (3)ACD/LogD (pH 7.4): 2.16; (4)ACD/BCF (pH 5.5): 25.75; (5)ACD/BCF (pH 7.4): 25.83; (6)ACD/KOC (pH 5.5): 355.67; (7)ACD/KOC (pH 7.4): 356.78; (8)#H bond acceptors: 2; (9)Index of Refraction: 1.74; (10)Molar Refractivity: 58.12 cm³; (11)Molar Volume: 144.1 cm³; (12)Surface Tension: 61.2 dyne/cm; (13)Density: 1.25 g/cm³; (14)Flash Point: 180.4 °C; (15)Enthalpy of Vaporization: 60.15 kJ/mol; (16)Boiling Point: 378.2 °C at 760 mmHg; (17)Vapour Pressure: 1.39E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: n1nccc3c1c2ccccc2cc3
(2)InChI: InChI=1/C12H8N2/c1-2-4-11-9(3-1)5-6-10-7-8-13-14-12(10)11/h1-8H
(3)InChIKey: DMMLYDCVMZEUMT-UHFFFAOYAF