The Benzoic acid,4-(1-methylethoxy)-, 2-(2-methyl-1-pyrrolidinyl)ethyl ester, with the CAS registry number 5411-23-4, has the molecular formula C₁₇H₂₅NO₃. Besides, its molecular weight is 291.3853. Its systematic name is called 2-(2-methylpyrrolidin-1-yl)ethyl 4-(propan-2-yloxy)benzoate.

Physical properties of Benzoic acid,4-(1-methylethoxy)-, 2-(2-methyl-1-pyrrolidinyl)ethyl ester: (1)ACD/LogP: 4.49; (2)#H bond acceptors: 4; (3)#Freely Rotating Bonds: 7; (4)Index of Refraction: 1.513; (5)Molar Refractivity: 83.29 cm³; (6)Molar Volume: 277 cm³; (7)Surface Tension: 36.5 dyne/cm; (8)Density: 1.051 g/cm³; (9)Flash Point: 195.6 °C; (10)Enthalpy of Vaporization: 65.07 kJ/mol; (11)Boiling Point: 399.9 °C at 760 mmHg; (12)Vapour Pressure: 1.33E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OCCN1C(CCC1)C)c2ccc(OC(C)C)cc2
(2)InChI: InChI=1/C17H25NO3/c1-13(2)21-16-8-6-15(7-9-16)17(19)20-12-11-18-10-4-5-14(18)3/h6-9,13-14H,4-5,10-12H2,1-3H3
(3)InChIKey: LZLUDVCQIWQCNH-UHFFFAOYAY