The Benzonitrile,4-(2H-tetrazol-5-yl)- is an organic compound with the molecular formula C₈H₅N₅. Its CAS registry number is 14389-10-7. The IUPAC name of this chemical is called 4-(2H-Tetrazol-5-yl)benzonitrile. What's more, the molecular weight of this chemical is 171.16.

Physical properties about Benzonitrile,4-(2H-tetrazol-5-yl)- are: (1)ACD/LogP: 1.30; (2)#of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 3.53; (6)ACD/KOC (pH 7.4): 1.23; (7)#H bond acceptors: 5; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 67.39 Å²; (11)Index of Refraction: 1.651; (12)Molar Refractivity: 43.34 cm³; (13)Molar Volume: 118.6 cm³; (14)Polarizability: 17.18×10^-24 cm³; (15)Surface Tension: 97.9 dyne/cm; (16)Density: 1.44 g/cm³; (17)Flash Point: 137.6 °C; (18)Enthalpy of Vaporization: 67.1 kJ/mol; (19)Boiling Point: 417.6 °C at 760 mmHg; (20)Vapour Pressure: 3.49E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: N#Cc2ccc(c1nnnn1)cc2
(2) InChI: InChI=1/C8H5N5/c9-5-6-1-3-7(4-2-6)8-10-12-13-11-8/h1-4H,(H,10,11,12,13)
(3) InChIKey: KFSAVNQQBAZFIP-UHFFFAOYAE