Basic Information | Post buying leads | Suppliers |
Name |
Butynediol sulfopropyl ether sodium |
EINECS | 290-883-0 |
CAS No. | 90268-78-3 | Density | 1.11~1.16g/cm3 |
PSA | 95.04000 | LogP | 0.01480 |
Solubility | N/A | Melting Point |
N/A |
Formula | C4H6O2.C3H6O3S.HNaO | Boiling Point | N/A |
Molecular Weight | 248.23 | Flash Point | N/A |
Transport Information | N/A | Appearance | Yellow-brown liquid |
Safety | Risk Codes | N/A | |
Molecular Structure | Hazard Symbols | N/A | |
Synonyms |
sulfuric acid propyl ester; 2-butyne-1,1-diol; |
The CAS registry number of Butynediol sulfopropyl ether sodium is 90268-78-3. Its EINECS registry number is 290-883-0. This chemical's molecular formula is C7H12NaO5S and molecular weight is 231.22. Its systematic name is called 3-(3-hydroxybut-1-ynoxy)propane-1-sulfonic acid; sodium hydride. What's more, this chemical can be used to make nickel plating brightener.
You can still convert the following datas into molecular structure:
(1)SMILES: CC(C#COCCCS(=O)(=O)O)O.[NaH]
(2)InChI: InChI=1/C7H12O5S.Na.H/c1-7(8)3-5-12-4-2-6-13(9,10)11;;/h7-8H,2,4,6H2,1H3,(H,9,10,11);;/rC7H12O5S.HNa/c1-7(8)3-5-12-4-2-6-13(9,10)11;/h7-8H,2,4,6H2,1H3,(H,9,10,11);1H
(3)InChIKey: IPCXNAIRHIBAOQ-WSNXLOELAV