The Coumarin 339 with the cas number 62669-73-2, is also called 2H-Pyrano(3,2-g)quinolin-2-one, 6,7,8,9-tetrahydro-4-methyl-. The systematic name is 4-methyl-6,7,8,9-tetrahydro-2H-pyrano[3,2-g]quinolin-2-one. Its molecular formula is C₁₃H₁₃NO₂. This chemical is yellow crystalline powder.

The properties of the chemical are: (1)ACD/LogP: 2.84; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.77; (4)ACD/LogD (pH 7.4): 2.84; (5)ACD/BCF (pH 5.5): 71.93; (6)ACD/BCF (pH 7.4): 84.68; (7)ACD/KOC (pH 5.5): 708.54; (8)ACD/KOC (pH 7.4): 834.11; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 29.54Ų; (13)Index of Refraction: 1.589; (14)Molar Refractivity: 59.99 cm³; (15)Molar Volume: 177.9 cm³; (16)Polarizability: 23.78×10^-24cm³; (17)Surface Tension: 43.6 dyne/cm; (18)Enthalpy of Vaporization: 65.9 kJ/mol; (19)Vapour Pressure: 7.72×10^-7 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C/3Oc2cc1NCCCc1cc2\C(=C\3)C
(2)InChI: InChI=1/C13H13NO2/c1-8-5-13(15)16-12-7-11-9(6-10(8)12)3-2-4-14-11/h5-7,14H,2-4H2,1H3