The D-Mannose, 6-deoxy-, with the CAS registry number 634-74-2, is also known as DL-Mannose, 6-deoxy-. This chemical's molecular formula is C₆H₁₂O₅ and molecular weight is 164.1565. Its systematic name is called 6-deoxy-D-mannose.

Physical properties of D-Mannose, 6-deoxy-: (1)ACD/LogP: -2.04; (2)#H bond acceptors: 5; (3)#H bond donors: 4; (4)#Freely Rotating Bonds: 8; (5)Index of Refraction: 1.53; (6)Molar Refractivity: 36 cm³; (7)Molar Volume: 116.4 cm³; (8)Surface Tension: 69.5 dyne/cm; (9)Density: 1.41 g/cm³; (10)Flash Point: 209.3 °C; (11)Enthalpy of Vaporization: 75.11 kJ/mol; (12)Boiling Point: 399.1 °C at 760 mmHg; (13)Vapour Pressure: 5E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C
(2)InChI: InChI=1/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4-,5-,6-/m1/s1
(3)InChIKey: PNNNRSAQSRJVSB-KVTDHHQDBL