The Benzenepropanoic acid, alpha,3,4-trihydroxy-, with the CAS registry number 23028-17-3, is also known as alpha-(3,4-Dihydroxyphenyl)lactic acid. This chemical's molecular formula is C₉H₁₀O₅ and molecular weight is 198.1727. Its IUPAC name is called 2-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid.

Physical properties of Benzenepropanoic acid, alpha,3,4-trihydroxy-: (1)ACD/LogP: -0.07; (2)ACD/LogD (pH 5.5): -2.54; (3)ACD/LogD (pH 7.4): -3.73; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 5; (11)Index of Refraction: 1.649; (12)Molar Refractivity: 46.86 cm³; (13)Molar Volume: 128.6 cm³; (14)Surface Tension: 79.5 dyne/cm; (15)Density: 1.54 g/cm³; (16)Flash Point: 258.4 °C; (17)Enthalpy of Vaporization: 78.45 kJ/mol; (18)Boiling Point: 480.3 °C at 760 mmHg; (19)Vapour Pressure: 4.91E-10 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)C(O)(c1cc(O)c(O)cc1)C
(2)InChI: InChI=1/C9H10O5/c1-9(14,8(12)13)5-2-3-6(10)7(11)4-5/h2-4,10-11,14H,1H3,(H,12,13)
(3)InChIKey: NDGMYGNFKSMYBB-UHFFFAOYAD