The Dicalciumdiphosphate, with the CAS registry number 35405-51-7, is also known as Diphosphoric acid,calcium salt (2:1). It belongs to the product category of Nutritional fortification substances. Its EINECS number is 232-221-5. This chemical's molecular formula is Ca₂O₇P₂ and molecular weight is 254.1. What's more, its systematic name is dicalcium diphosphate.

Physical properties of Dicalciumdiphosphate are: (1)ACD/LogP: -3.42; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -7.96; (4)ACD/LogD (pH 7.4): -8.64; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)#H bond acceptors: 7; (8)#H bond donors: 4; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 143.91 Å².

You can still convert the following datas into molecular structure:
(1)SMILES: [Ca+2].[Ca+2].[O-]P([O-])(=O)OP([O-])([O-])=O
(2)InChI: InChI=1S/2Ca.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+2;/p-4
(3)InChIKey: JUNWLZAGQLJVLR-UHFFFAOYSA-J