The CAS registry number of Diethyl hydrogen phosphate, compound with guanidine (2:1) is 94094-82-3. Its EINECS registry number is 302-184-0. This chemical's molecular formula is C₉H₂₇N₃O₈P₂ and molecular weight is 367.273502. Its IUPAC name is called diethyl hydrogen phosphate; guanidine.

Physical properties of Diethyl hydrogen phosphate, compound with guanidine (2:1): (1)# of Rule of 5 Violations: 2; (2)#H bond acceptors: 11; (3)#H bond donors: 7; (4)#Freely Rotating Bonds: 8; (5)Flash Point: 257.5 °C; (6)Enthalpy of Vaporization: 84.42 kJ/mol; (7)Boiling Point: 502.2 °C at 760 mmHg; (8)Vapour Pressure: 1.9E-11 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCOP(=O)(O)OCC.CCOP(=O)(O)OCC.C(=N)(N)N
(2)InChI: InChI=1S/2C4H11O4P.CH5N3/c2*1-3-7-9(5,6)8-4-2;2-1(3)4/h2*3-4H2,1-2H3,(H,5,6);(H5,2,3,4)
(3)InChIKey: SWMAWYCZGIXKPX-UHFFFAOYSA-N