The Benzeneethanamine,N-ethyl-4-methoxy-α-methyl-, hydrochloride (1:1), with the CAS registry number 93963-24-7, is also known as 4-(2-Ethylaminopropyl)anisole hydrochloride. It belongs to the product category of APIS. Its EINECS registry number is 300-765-3. This chemical's molecular formula is C₁₂H₂₀ClNO and molecular weight is 229.7463. Its IUPAC name is called N-ethyl-1-(4-methoxyphenyl)propan-2-amine hydrochloride. This chemical's classification code is Drug / Therapeutic Agent.

Physical properties of Benzeneethanamine,N-ethyl-4-methoxy-α-methyl-, hydrochloride (1:1): (1)ACD/LogP: 2.39; (2)#H bond acceptors: 2; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 5; (5)Flash Point: 116.1 °C; (6)Enthalpy of Vaporization: 51.94 kJ/mol; (7)Boiling Point: 280.6 °C at 760 mmHg; (8)Vapour Pressure: 0.00374 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCNC(C)CC1=CC=C(C=C1)OC.Cl
(2)InChI: InChI=1S/C12H19NO.ClH/c1-4-13-10(2)9-11-5-7-12(14-3)8-6-11;/h5-8,10,13H,4,9H2,1-3H3;1H
(3)InChIKey: KWQLOEWGKCQLPR-UHFFFAOYSA-N

The toxicity data is as follows: