The Furan,2,5-bis(trimethylsilyl)-, with the CAS registry number 1578-29-6, is also known as 2,5-Bis(trimethylsilyl)furan. This chemical's molecular formula is C₁₀H₂₀OSi₂ and molecular weight is 212.4362. Its IUPAC name is called trimethyl-(5-trimethylsilylfuran-2-yl)silane.

Physical properties of Furan,2,5-bis(trimethylsilyl)-: (1)ACD/LogP: 6.38; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 6.38; (4)ACD/LogD (pH 7.4): 6.38; (5)ACD/BCF (pH 5.5): 41785.73; (6)ACD/BCF (pH 7.4): 41785.73; (7)ACD/KOC (pH 5.5): 70682.95; (8)ACD/KOC (pH 7.4): 70682.95; (9)#H bond acceptors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.446; (12)Molar Refractivity: 64.51 cm³; (13)Molar Volume: 241.7 cm³; (14)Surface Tension: 20.9 dyne/cm; (15)Density: 0.87 g/cm³; (16)Flash Point: 64.4 °C; (17)Enthalpy of Vaporization: 40.2 kJ/mol; (18)Boiling Point: 182.9 °C at 760 mmHg; (19)Vapour Pressure: 1.08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C[Si](C)(C)C1=CC=C(O1)[Si](C)(C)C
(2)InChI: InChI=1S/C10H20OSi2/c1-12(2,3)9-7-8-10(11-9)13(4,5)6/h7-8H,1-6H3
(3)InChIKey: WRTMWEMDOPVALX-UHFFFAOYSA-N