The Furo[2,3-c]pyridine, with the CAS registry number 19539-50-5, is also known as 7-Oxa-4-azabicyclo[4.3.0]nona-2,4,8,10-tetraene. This chemical's molecular formula is C₇H₅NO and molecular weight is 119.1207. Its IUPAC name is called furo[2,3-c]pyridine.

Physical properties of Furo[2,3-c]pyridine: (1)ACD/LogP: 1.34; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 4; (5)ACD/BCF (pH 7.4): 5; (6)ACD/KOC (pH 5.5): 99; (7)ACD/KOC (pH 7.4): 104; (8)#H bond acceptors: 2; (9)Index of Refraction: 1.609; (10)Molar Refractivity: 34.486 cm³; (11)Molar Volume: 99.568 cm³; (12)Surface Tension: 45.952 dyne/cm; (13)Density: 1.196 g/cm³; (14)Flash Point: 77.771 °C; (15)Enthalpy of Vaporization: 41.637 kJ/mol; (16)Boiling Point: 197.918 °C at 760 mmHg; (17)Vapour Pressure: 0.52 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CN=CC2=C1C=CO2
(2)InChI: InChI=1S/C7H5NO/c1-3-8-5-7-6(1)2-4-9-7/h1-5H
(3)InChIKey: ZYXBIOIYWUIXSM-UHFFFAOYSA-N