The Furo[3,4-d]pyrimidine-2,4,7(3H)-trione,1,5-dihydro-, with the CAS registry number 4156-75-6, is also known as NSC667243. This chemical's molecular formula is C₆H₄N₂O₄ and molecular weight is 168.017107. Its IUPAC name is called 1,5-dihydrofuro[3,4-d]pyrimidine-2,4,7-trione. 

Physical properties of Furo[3,4-d]pyrimidine-2,4,7(3H)-trione,1,5-dihydro-: (1)ACD/LogP: -2.05; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1.8; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 6; (7)#H bond donors: 2; (8)Index of Refraction: 1.631; (9)Molar Refractivity: 34.58 cm³; (10)Molar Volume: 96.9 cm³; (11)Surface Tension: 73.2 dyne/cm; (12)Density: 1.73 g/cm³.

Uses of Furo[3,4-d]pyrimidine-2,4,7(3H)-trione,1,5-dihydro-: it can be used to produce 6-methoxycarbonyl-5-methoxymethyluracil. This reaction will need reagent HCl gas. The yield is about 77.6%.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1C2=C(C(=O)O1)NC(=O)NC2=O
(2)InChI: InChI=1S/C6H4N2O4/c9-4-2-1-12-5(10)3(2)7-6(11)8-4/h1H2,(H2,7,8,9,11)
(3)InChIKey: MFHLWNMYHQMDMV-UHFFFAOYSA-N