The Methylene, nitro-(8CI,9CI), with the CAS registry number 19527-13-0, is also known as Nitrocarbene. This chemical's molecular formula is CHNO₂ and molecular weight is 61.04. What's more, its systematic name and its IUPAC name are the same which is called Nitromethane.

Physical properties about Methylene, nitro-(8CI,9CI): (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 18.65; (5)ACD/KOC (pH 7.4): 18.62; (6)#H bond acceptors: 3; (7)#H bond donors: 0; (8)#Freely Rotating Bonds: 0; (9)Polar Surface Area: 45.82 Å²; (10)Flash Point: 22.7 °C; (11)Enthalpy of Vaporization: 31.2 kJ/mol; (12)Boiling Point: 85.1 °C at 760 mmHg; (13)Vapour Pressure: 78.6 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: [CH]N(=O)=O
(2) InChI: InChI=1/CHNO2/c1-2(3)4/h1H
(3) InChIKey: AFMIYEXCCPCEKD-UHFFFAOYAD

The toxicity data is as follows: