The N,N,N',N'-Tetramethylpiperazine-1,4-diethylamine, with the CAS registry number 10586-98-8, is also known as {2-[4-(2-Dimethylamino-ethyl)-piperazin-1-yl]-ethyl}-dimethyl-amine. Its EINECS number is 234-189-8. This chemical's molecular formula is C₁₂H₂₈N₄ and molecular weight is 228.38. What's more, its systematic name is 2,2'-piperazine-1,4-diylbis(N,N-dimethylethanamine). 

Physical properties of N,N,N',N'-Tetramethylpiperazine-1,4-diethylamine are: (1)ACD/LogP: -0.30; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -4.45; (4)ACD/LogD (pH 7.4): -4.27; (5)ACD/BCF (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 0; (9)#Freely Rotating Bonds: 6; (10)Polar Surface Area: 12.96 Å²; (11)Index of Refraction: 1.486; (12)Molar Refractivity: 70.2 cm³; (13)Molar Volume: 244.2 cm³; (14)Surface Tension: 33.2 dyne/cm; (15)Density: 0.934 g/cm³; (16)Flash Point: 114.4 °C; (17)Enthalpy of Vaporization: 53.02 kJ/mol; (18)Boiling Point: 290.8 °C at 760 mmHg; (19)Vapour Pressure: 0.00203 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: N(CCN1CCN(CC1)CCN(C)C)(C)C
(2)InChI: InChI=1S/C12H28N4/c1-13(2)5-7-15-9-11-16(12-10-15)8-6-14(3)4/h5-12H2,1-4H3
(3)InChIKey: RUPSPYXFXWDVBV-UHFFFAOYSA-N