The L-Arginine, N²-acetyl-, with the CAS registry number 155-84-0, is also known as N-Acetyl-L-arginine. It belongs to the product categories of Amino Acids; A - H; Amino Acids; Modified Amino Acids. Its EINECS registry number is 205-846-6. This chemical's molecular formula is C₈H₁₆N₄O₃ and molecular weight is 216.24. What's more, its IUPAC name is called (2S)-2-Acetamido-5-(diaminomethylideneamino)pentanoic acid.

Physical properties about L-Arginine, N²-acetyl- are: (1)# of Rule of 5 Violations: 1; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 7; (7)#H bond donors: 6; (8)#Freely Rotating Bonds: 6; (9)Polar Surface Area: 128.3 Å²; (10)Index of Refraction: 1.58; (11)Molar Refractivity: 51.72 cm³; (12)Molar Volume: 155.385 cm³; (13)Surface Tension: 56.79 dyne/cm; (14)Density: 1.392 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: CC(=O)N[C@@H](CCCNC(=N)N)C(=O)O
(2) InChI: InChI=1/C8H16N4O3/c1-5(13)12-6(7(14)15)3-2-4-11-8(9)10/h6H,2-4H2,1H3,(H,12,13)(H,14,15)(H4,9,10,11)/t6-/m0/s1
(3) InChIKey: SNEIUMQYRCDYCH-LURJTMIEBE