Chemical Property of 1,3-bis[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]thiourea
Edit
Chemical Property:
- Vapor Pressure:0mmHg at 25°C
- Boiling Point:675.065°C at 760 mmHg
- Flash Point:362.066°C
- Density:1.399g/cm3
- XLogP3:0.6
- Hydrogen Bond Donor Count:6
- Hydrogen Bond Acceptor Count:5
- Rotatable Bond Count:6
- Exact Mass:424.19061198
- Heavy Atom Count:30
- Complexity:648
- Purity/Quality:
-
99%, *data from raw suppliers
Safty Information:
- Pictogram(s):
- Hazard Codes:
- MSDS Files:
-
SDS file from LookChem
Useful:
- Canonical SMILES:CC(=NN=C(N)N)C1=CC(=CC=C1)NC(=S)NC2=CC=CC(=C2)C(=NN=C(N)N)C
- Isomeric SMILES:C/C(=N\N=C(N)N)/C1=CC(=CC=C1)NC(=S)NC2=CC=CC(=C2)/C(=N/N=C(N)N)/C
-
Use Description
1,3-bis(3-{(1E)-1-[(diaminomethylidene)hydrazinylidene]ethyl}phenyl)thiourea, a specific chemical compound, serves distinct roles in various fields. In the realm of coordination chemistry and materials science, it plays a pivotal role as a ligand for the synthesis of coordination compounds and metal-organic frameworks, contributing to the development of innovative materials with diverse properties and potential applications in catalysis and gas storage. In the field of organometallic chemistry, this compound may be explored for its potential reactivity in metal-catalyzed reactions, aiding in the creation of new organic compounds and the investigation of catalytic processes. Moreover, in the study of supramolecular chemistry, it can serve as a building block for the creation of intricate molecular assemblies, facilitating research into host-guest interactions and molecular recognition. Its applications in coordination chemistry, organometallic chemistry, and supramolecular chemistry underscore its significance in driving material innovation, advancing chemical synthesis, and enhancing our understanding of molecular interactions within these diverse domains.
