The CAS registry number of Pyrazine,2-ethyl-6-methoxy- is 67845-38-9. This chemical's molecular formula is C₇H₁₀N₂O and molecular weight is 138.1671. Its systematic name is called 2-ethyl-6-methoxypyrazine.

Physical properties of Pyrazine,2-ethyl-6-methoxy-: (1)ACD/LogP: 1.74; (2)ACD/LogD (pH 5.5): 1.74; (3)ACD/LogD (pH 7.4): 1.74; (4)ACD/BCF (pH 5.5): 12.44; (5)ACD/BCF (pH 7.4): 12.44; (6)ACD/KOC (pH 5.5): 211.54; (7)ACD/KOC (pH 7.4): 211.55; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.494; (11)Molar Refractivity: 38.66 cm³; (12)Molar Volume: 132.7 cm³; (13)Surface Tension: 37.7 dyne/cm; (14)Density: 1.041 g/cm³; (15)Flash Point: 67.3 °C; (16)Enthalpy of Vaporization: 40.62 kJ/mol; (17)Boiling Point: 187.3 °C at 760 mmHg; (18)Vapour Pressure: 0.872 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O(c1nc(cnc1)CC)C
(2)InChI: InChI=1/C7H10N2O/c1-3-6-4-8-5-7(9-6)10-2/h4-5H,3H2,1-2H3
(3)InChIKey: ROWQNTVAFQMDSV-UHFFFAOYAG