The CAS registry number of Pyridine,3-chloro-4-phenyl- is 90732-01-7. This chemical's molecular formula is C₁₁H₈ClN and molecular weight is 189.64. Its systematic name is called 3-chloro-4-phenylpyridine.

Physical properties of Pyridine,3-chloro-4-phenyl-: (1)ACD/LogP: 3.32; (2)ACD/LogD (pH 5.5): 3.31; (3)ACD/LogD (pH 7.4): 3.32; (4)ACD/BCF (pH 5.5): 194.42; (5)ACD/BCF (pH 7.4): 195.21; (6)ACD/KOC (pH 5.5): 1511.38; (7)ACD/KOC (pH 7.4): 1517.54; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.588; (11)Molar Refractivity: 53.83 cm³; (12)Molar Volume: 159.8 cm³; (13)Surface Tension: 43.5 dyne/cm; (14)Density: 1.186 g/cm³; (15)Flash Point: 143.9 °C; (16)Enthalpy of Vaporization: 48.89 kJ/mol; (17)Boiling Point: 271.2 °C at 760 mmHg; (18)Vapour Pressure: 0.0109 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc2c(c1ccccc1)ccnc2
(2)InChI: InChI=1/C11H8ClN/c12-11-8-13-7-6-10(11)9-4-2-1-3-5-9/h1-8H
(3)InChIKey: FVAFHXOWOYVPIV-UHFFFAOYAN