The Spiro[1H-indene-1,4'-piperidine], with the CAS registry number 33042-66-9, is also known as Spiro[1H-indeno-1,4'-piperidine]. This chemical's molecular formula is C₁₃H₁₅N and molecular weight is 185.26. What's more, its systematic name is spiro[indene-1,4'-piperidine]. 

Physical properties of Spiro[1H-indene-1,4'-piperidine] are: (1)ACD/LogP: 2.91; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.026; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1.189; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 0; (11)Polar Surface Area: 12.03 Å²; (12)Index of Refraction: 1.613; (13)Molar Refractivity: 58.644 cm³; (14)Molar Volume: 168.572 cm³; (15)Polarizability: 23.248×10^-24cm³; (16)Surface Tension: 44.536 dyne/cm; (17)Density: 1.099 g/cm³; (18)Flash Point: 155.442 °C; (19)Enthalpy of Vaporization: 56.024 kJ/mol; (20)Boiling Point: 318.721 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CNCCC12C=CC3=CC=CC=C23
(2)InChI: InChI=1S/C13H15N/c1-2-4-12-11(3-1)5-6-13(12)7-9-14-10-8-13/h1-6,14H,7-10H2
(3)InChIKey: QXNXVWNYCKUANQ-UHFFFAOYSA-N