The Thiophene,2-(3-thienylthio)-, with the CAS registry number 3807-37-2, is also known as 2-(3-Thienylsulfanyl)thiophene. This chemical's molecular formula is C₈H₆S₃ and molecular weight is 198.33. Its systematic name is called 2-(thiophen-3-ylsulfanyl)thiophene.

Physical properties of Thiophene,2-(3-thienylthio)-: (1)ACD/LogP: 3.81; (2)ACD/LogD (pH 5.5): 3.81; (3)ACD/LogD (pH 7.4): 3.81; (4)ACD/BCF (pH 5.5): 459.81; (5)ACD/BCF (pH 7.4): 459.81; (6)ACD/KOC (pH 5.5): 2802.08; (7)ACD/KOC (pH 7.4): 2802.08; (8)#Freely Rotating Bonds: 2; (9)Index of Refraction: 1.697; (10)Molar Refractivity: 55.75 cm³; (11)Molar Volume: 144.5 cm³; (12)Surface Tension: 58.3 dyne/cm; (13)Density: 1.37 g/cm³; (14)Flash Point: 144.3 °C; (15)Enthalpy of Vaporization: 53.4 kJ/mol; (16)Boiling Point: 315 °C at 760 mmHg; (17)Vapour Pressure: 0.000832 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: s2cc(Sc1sccc1)cc2
(2)InChI: InChI=1/C8H6S3/c1-2-8(10-4-1)11-7-3-5-9-6-7/h1-6H
(3)InChIKey: XZMYDSUNRUYCNA-UHFFFAOYAB