Products Categories
CAS No.: | 102029-81-2 |
---|---|
Name: | DL-ALANINE-1-13C |
Molecular Structure: | |
Formula: | C3H7NO2 |
Molecular Weight: | 90.0831 |
Synonyms: | (R,S)-Alanine;(RS)-2-Aminopropionsaeure;2-Aminopropanoic acid;2-Aminopropans?ure;2-Aminopropionic Acid;Acide 2-aminopropano?que; |
EINECS: | 200-273-8 |
Density: | 1.161 g/cm3 |
Melting Point: | 289 °C (dec.)(lit.) |
PSA: | 63.32000 |
LogP: | 0.11850 |
The Alanine-1-13C (9CI), with the CAS registry number 102029-81-2, is also known as Alanine-1-13C. It belongs to the product categories of Amino Acids 13C, 2H, 15N; A; Alphabetical Listings; Stable Isotopes. This chemical's molecular formula is C3H7NO2 and molecular weight is 90.1. What's more, its systematic name is alanine.
Physical properties of Alanine-1-13C (9CI) are: (1)Index of Refraction: 1.459; (2)Molar Refractivity: 21 cm3; (3)Molar Volume: 76.7 cm3; (4)Polarizability: 8.32×10-24 cm3; (5)Surface Tension: 45.8 dyne/cm; (6)Density: 1.161 g/cm3.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC(C(=O)O)N
(2)InChI: InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)
(3)InChIKey: QNAYBMKLOCPYGJ-UHFFFAOYAA