Products Categories
CAS No.: | 14216-75-2 |
---|---|
Name: | Nickel Nitrate |
Molecular Structure: | |
Formula: | N2NiO6 |
Molecular Weight: | 181.91 |
Synonyms: | Nitric acid, nickel(2+) salt;Nickel(2+) dinitrate;Nickel(2+)ato(2-) dinitratato(2-); |
EINECS: | 238-076-4 |
Density: | 2.05 |
Melting Point: | 56.7oC |
Boiling Point: | 83 °C at 760 mmHg |
PSA: | 137.76000 |
LogP: | 0.56820 |
This chemical is called Nitric acid, nickel salt, and its CAS registry number is 14216-75-2. With the molecular formula of H2N2NiO6, its molecular weight is 182.70. Additionally, its classification code is Reportable Quantity (RQ) = 100 lb. It's used as plating, ceramic, nickel salt production and catalyst.
Other characteristics of the Nitric acid, nickel salt can be summarised as followings: (1)ACD/LogP: -0.13; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.13; (4)ACD/LogD (pH 7.4): -0.13; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 0; (10)Polar Surface Area: 66.05 Å2; (11)Flash Point: °C; (12)Enthalpy of Vaporization: 37.72 kJ/mol; (13)Boiling Point: 83 °C at 760 mmHg; (14)Vapour Pressure: 49.8 mmHg at 25°C.
You can still convert the following datas into molecular structure:
1.SMILES: [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O
2.InChI: InChI=1/2NO3.Ni/c2*2-1(3)4;/q2*-1;+2
3.InChIKey: KBJMLQFLOWQJNF-UHFFFAOYAP