Products Categories
CAS No.: | 183322-45-4 |
---|---|
Name: | PD153035 HCl |
Molecular Structure: | |
Formula: | C16H15BrClN3O2 |
Molecular Weight: | 396.67 |
Synonyms: | 6,7-Dimethoxy-4-[N-(3-bromophenyl)amino]quinazoline hydrochloride;4-Quinazolinamine,N-(3-bromophenyl)-6,7-dimethoxy-, monohydrochloride (9CI);N-(3-Bromophenyl)-6,7-dimethoxyquinazolin-4-amine hydrochloride (1:1);PD 153035 hydrochloride; |
Melting Point: | 265°C(lit.) |
Boiling Point: | 472.1 °C at 760 mmHg |
Flash Point: | 239.3 °C |
Hazard Symbols: | T |
Risk Codes: | 25-37/38-41 |
Safety: | 26-39-45 |
PSA: | 56.27000 |
LogP: | 5.02810 |
The 4-Quinazolinamine,N-(3-bromophenyl)-6,7-dimethoxy-, hydrochloride (1:1), with the CAS registry number 183322-45-4, is also known as 4-Quinazolinamine, N-(3-bromophenyl)-6,7-dimethoxy-, monohydrochloride. This chemical's molecular formula is C16H15BrClN3O2 and molecular weight is 396.67. What's more, its systematic name is N-(3-Bromophenyl)-6,7-dimethoxyquinazolin-4-amine hydrochloride (1:1).
Physical properties of 4-Quinazolinamine,N-(3-bromophenyl)-6,7-dimethoxy-, hydrochloride (1:1) are: (1)ACD/LogP: 2.58; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.4; (4)ACD/LogD (pH 7.4): 2.58; (5)ACD/BCF (pH 5.5): 35.36; (6)ACD/BCF (pH 7.4): 53.63; (7)ACD/KOC (pH 5.5): 396.15; (8)ACD/KOC (pH 7.4): 600.8; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 47.48 Å2; (13)Flash Point: 239.3 °C; (14)Enthalpy of Vaporization: 73.5 kJ/mol; (15)Boiling Point: 472.1 °C at 760 mmHg; (16)Vapour Pressure: 4.38E-09 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Cl.Brc1cccc(c1)Nc3ncnc2c3cc(OC)c(OC)c2
(2)InChI: InChI=1S/C16H14BrN3O2.ClH/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11;/h3-9H,1-2H3,(H,18,19,20);1H
(3)InChIKey: ZJOKWAWPAPMNIM-UHFFFAOYSA-N