Products Categories
CAS No.: | 27146-64-1 |
---|---|
Name: | 6-Hydrazinouracil |
Molecular Structure: | |
Formula: | C4H6N4O2 |
Molecular Weight: | 142.11604 |
Synonyms: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,4-hydrazone (9CI);Uracil, 6-hydrazino- (6CI,7CI,8CI);6-Hydrazinouracil;NSC118396; |
Density: | 1.92 g/cm3 |
PSA: | 96.58000 |
LogP: | -0.15400 |
The 2,4(3H,5H)-Pyrimidinedione,6-hydrazinyl-, with the CAS registry number 27146-64-1, is also known as NSC118396. It belongs to the product category of Pyrimidine. This chemical's molecular formula is C4H6N4O2 and molecular weight is 142.11604. Its IUPAC name is called 6-hydrazinyl-5H-pyrimidine-2,4-dione.
Physical properties of 2,4(3H,5H)-Pyrimidinedione,6-hydrazinyl-: (1)ACD/LogP: -2.29; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 2.96; (5)ACD/KOC (pH 7.4): 2.8; (6)#H bond acceptors: 6; (7)#H bond donors: 4; (8)#Freely Rotating Bonds: 1; (9)Index of Refraction: 1.789; (10)Molar Refractivity: 31.2 cm3; (11)Molar Volume: 73.7 cm3; (12)Surface Tension: 97.5 dyne/cm; (13)Density: 1.92 g/cm3.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1C(=O)NC(=O)N=C1NN
(2)InChI: InChI=1S/C4H6N4O2/c5-8-2-1-3(9)7-4(10)6-2/h1,5H2,(H2,6,7,8,9,10)
(3)InChIKey: QGIANYJQIJBTRC-UHFFFAOYSA-N