100187-10-8 Usage
Description
Ethyl 2-(5-methyl-4H-1,2,4-triazol-3-yl)acetate is an organic compound that belongs to the triazole family. It is characterized by its unique chemical structure, which features a triazole ring fused to an acetate group. Ethyl 2-(5-methyl-4H-1,2,4-triazol-3-yl)acetate is known for its potential applications in various fields due to its versatile chemical properties.
Uses
Used in Pharmaceutical Industry:
Ethyl 2-(5-methyl-4H-1,2,4-triazol-3-yl)acetate is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of triazolylacetic acid derivatives, which can be further modified to create new drugs with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, Ethyl 2-(5-methyl-4H-1,2,4-triazol-3-yl)acetate serves as a valuable building block for the creation of novel chemical entities. Its reactivity and structural diversity make it an attractive candidate for the development of new materials and compounds with specific properties and applications.
Used in Material Science:
The unique structure of Ethyl 2-(5-methyl-4H-1,2,4-triazol-3-yl)acetate also makes it a candidate for use in material science. Its potential applications may include the development of new polymers, coatings, or other materials with specific properties, such as improved stability, reactivity, or biocompatibility.
Check Digit Verification of cas no
The CAS Registry Mumber 100187-10-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,1,8 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 100187-10:
(8*1)+(7*0)+(6*0)+(5*1)+(4*8)+(3*7)+(2*1)+(1*0)=68
68 % 10 = 8
So 100187-10-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O2/c1-3-12-7(11)4-6-8-5(2)9-10-6/h3-4H2,1-2H3,(H,8,9,10)