100900-16-1 Usage
Description
1,4-Chrysenequinone is a polycyclic aromatic quinone known for its ability to act as an activator of the aryl hydrocarbon receptor (AhR). This chemical compound is characterized by its unique molecular structure, which allows it to interact with specific biological targets and influence various cellular processes.
Uses
1. Used in Pharmaceutical Applications:
1,4-Chrysenequinone is used as a pharmaceutical agent for its ability to activate the aryl hydrocarbon receptor (AhR). This activation can have potential therapeutic implications in various diseases and conditions, as the AhR plays a crucial role in cellular signaling and regulation.
2. Used in Chemical Research:
1,4-Chrysenequinone is utilized as a research compound in the field of chemical biology, where it can be employed to study the structure-activity relationships of AhR agonists and antagonists. This knowledge can be applied to the development of novel drugs targeting the AhR pathway.
3. Used in Environmental Monitoring:
Due to its interaction with the aryl hydrocarbon receptor, 1,4-chrysenequinone can be used as a marker compound in environmental monitoring studies. It can help assess the presence of AhR-active compounds in the environment, which may have implications for human health and ecosystem integrity.
4. Used in Material Science:
The unique chemical properties of 1,4-chrysenequinone make it a potential candidate for applications in material science, such as in the development of novel electronic materials or as a component in advanced composites.
Check Digit Verification of cas no
The CAS Registry Mumber 100900-16-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,0,9,0 and 0 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 100900-16:
(8*1)+(7*0)+(6*0)+(5*9)+(4*0)+(3*0)+(2*1)+(1*6)=61
61 % 10 = 1
So 100900-16-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H10O2/c19-16-9-10-17(20)18-14-6-5-11-3-1-2-4-12(11)13(14)7-8-15(16)18/h1-10H
100900-16-1Relevant articles and documents
Improved synthesis of 1,4-phenanthrenequinones from Diels-Alder cycloadditions of 2-(p-Tolylsulfinyl)-1,4-benzoquinone
Carreno, M. Carmen,Mahugo, Jesus,Urbano, Antonio
, p. 3047 - 3050 (1997)
A wide range of substituted 1,4-phenanthrenequinones 5a-g and benz[c]- and benz[a]-1,4-phenanthrenequinones (5h) and (5i) were synthezised in one step through Diels-Alder cycloadditions of 2-(p-tolylsulfinyl)-1,4-benzoquinone 2 and vinylaromatic derivatives 1a-i under thermal and high pressure conditions in moderate to good yields (33-80%).