101018-97-7 Usage
Description
(2,3-Dihydro-1,4-benzodioxin-6-yl)(4-fluorophenyl)methanone is an organic compound characterized by the presence of a benzodioxin ring and a fluorophenyl group attached to a methanone functional group. This synthetic chemical is not typically found in nature and may serve as an intermediate in the synthesis of other compounds or as a research chemical for investigating the structure and properties of similar molecules. Its chemical structure hints at potential pharmaceutical or medicinal applications, which would require further research and experimentation to explore its specific uses and properties.
Used in Pharmaceutical Industry:
(2,3-Dihydro-1,4-benzodioxin-6-yl)(4-fluorophenyl)methanone is used as a chemical intermediate for the synthesis of pharmaceutical compounds due to its unique structure and functional groups that can be further modified or incorporated into more complex molecules.
Used in Research and Development:
As a research chemical, (2,3-Dihydro-1,4-benzodioxin-6-yl)(4-fluorophenyl)methanone is utilized for studying the structure and properties of similar molecules, which can contribute to the advancement of knowledge in organic chemistry and potentially lead to the discovery of new applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 101018-97-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,0,1 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 101018-97:
(8*1)+(7*0)+(6*1)+(5*0)+(4*1)+(3*8)+(2*9)+(1*7)=67
67 % 10 = 7
So 101018-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H11FO3/c16-12-4-1-10(2-5-12)15(17)11-3-6-13-14(9-11)19-8-7-18-13/h1-6,9H,7-8H2
