101257-82-3 Usage
Description
4-Pyrimidinamine, 5-chloro(9CI) is an organic compound with the molecular formula C4H4ClN3. It is a derivative of pyrimidine, a heterocyclic compound with potential applications in various fields due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
4-Pyrimidinamine, 5-chloro(9CI) is used as a reactant for the preparation of palladium-catalyzed C-N bond formation reactions. This is particularly relevant in the synthesis of complex molecules, such as bromocyclopropyl(pyridinylmethyl)quinazolinone, which can be further modified with amines to create new compounds with potential pharmaceutical applications.
Additionally, due to its chemical structure, 4-Pyrimidinamine, 5-chloro(9CI) may also be used as a building block for the development of new drugs targeting various diseases, including cancer, viral infections, and other conditions. Its versatility in chemical reactions allows for the creation of a wide range of molecular structures with potential therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 101257-82-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,2,5 and 7 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 101257-82:
(8*1)+(7*0)+(6*1)+(5*2)+(4*5)+(3*7)+(2*8)+(1*2)=83
83 % 10 = 3
So 101257-82-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H4ClN3/c5-3-1-7-2-8-4(3)6/h1-2H,(H2,6,7,8)
