102249-45-6 Usage
Description
2,4-DIBROMO-3-AMINOPYRIDINE is an organic compound characterized by the presence of a pyridine ring with two bromine atoms at the 2nd and 4th positions and an amino group at the 3rd position. This unique structure endows it with valuable chemical properties, making it a significant building block in the synthesis of various pharmaceuticals and organic compounds.
Uses
Used in Pharmaceutical Industry:
2,4-DIBROMO-3-AMINOPYRIDINE is used as a versatile reactant for the synthesis of novel indolizine 2-oxoacetamides. These compounds have potential applications as inhibitors of phosphodiesterase IV and tumor necrosis factor-α production in human peripheral blood mononuclear cells. By targeting these pathways, these synthesized compounds can contribute to the development of new therapeutic agents for treating various inflammatory and immune-related disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 102249-45-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,2,4 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 102249-45:
(8*1)+(7*0)+(6*2)+(5*2)+(4*4)+(3*9)+(2*4)+(1*5)=86
86 % 10 = 6
So 102249-45-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H4Br2N2/c6-3-1-2-9-5(7)4(3)8/h1-2H,8H2
