10238-27-4 Usage
Description
2-NITROPHENYL-BETA-D-XYLOPYRANOSIDE, with the CAS number 10238-27-4, is a pale yellow solid compound that is primarily utilized in the field of organic synthesis. It is a derivative of xylopyranosides, which are important components in various biological systems and have potential applications in different industries due to their unique chemical properties.
Uses
Used in Organic Synthesis:
2-NITROPHENYL-BETA-D-XYLOPYRANOSIDE is used as a synthetic building block for the creation of various complex organic molecules. Its unique structure allows chemists to manipulate and modify it to synthesize a wide range of compounds with specific properties and functions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-NITROPHENYL-BETA-D-XYLOPYRANOSIDE is used as a key intermediate in the synthesis of drugs targeting specific biological pathways. Its structural diversity and compatibility with various functional groups make it a valuable component in the development of novel therapeutic agents.
Used in Chemical Research:
2-NITROPHENYL-BETA-D-XYLOPYRANOSIDE is also employed as a research tool in chemical laboratories. Its unique properties and reactivity enable scientists to study various chemical reactions and mechanisms, contributing to the advancement of chemical knowledge and the development of new synthetic strategies.
Used in Material Science:
In the field of material science, 2-NITROPHENYL-BETA-D-XYLOPYRANOSIDE can be used as a component in the development of novel materials with specific properties, such as improved mechanical strength, thermal stability, or biocompatibility. Its incorporation into polymers or other materials can lead to the creation of innovative products with enhanced performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 10238-27-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,3 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10238-27:
(7*1)+(6*0)+(5*2)+(4*3)+(3*8)+(2*2)+(1*7)=64
64 % 10 = 4
So 10238-27-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO7/c13-7-5-18-11(10(15)9(7)14)19-8-4-2-1-3-6(8)12(16)17/h1-4,7,9-11,13-15H,5H2/t7-,9+,10-,11+/m1/s1
