10254-99-6 Usage
Description
NORSOLORINICACID, also known as a polyketide anthraquinone, is a chemical compound characterized by its unique structure. It features four hydroxy substituents at positions 1, 3, 6, and 8, along with a hexanoyl substituent at position 2. This distinctive molecular arrangement endows NORSOLORINICACID with potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
NORSOLORINICACID is used as a pharmaceutical compound for its unique molecular structure and potential therapeutic properties. Its hydroxy and hexanoyl substituents may allow for interactions with specific biological targets, making it a candidate for the development of new drugs or therapies.
Used in Chemical Research:
In the field of chemical research, NORSOLORINICACID serves as a valuable subject for studying the properties and reactivity of polyketide anthraquinones. Its distinct structural features can provide insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Used in Material Science:
NORSOLORINICACID's unique molecular structure may also find applications in material science, where it could be utilized in the development of novel materials with specific properties. Its hydroxy and hexanoyl substituents could potentially be exploited to create materials with tailored characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10254-99-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,5 and 4 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10254-99:
(7*1)+(6*0)+(5*2)+(4*5)+(3*4)+(2*9)+(1*9)=76
76 % 10 = 6
So 10254-99-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H18O7/c1-2-3-4-5-12(22)17-14(24)8-11-16(20(17)27)19(26)15-10(18(11)25)6-9(21)7-13(15)23/h6-8,21,23-24,27H,2-5H2,1H3
10254-99-6Relevant articles and documents
Cycloaddition of cross-conjugated trienes to halogenated quinones
Couturier,Brassard
, p. 703 - 708 (2007/10/02)
The chemoselectivity of [4+2] cycloadditions involving electron-rich cross-conjugated trienes and halogenated quinones has been examined. The approach provides improved preparations of 6-acetyl-2,3,7-trihydroxyjuglone, solorinic and norsolorinic acids, and averythrin. It also confirms the structure proposed for haematommone and 3,8-dihydroxy-4-methoxy-2-methoxycarbonyl-1-methylanthraquinone but invalidates that of sopheranin.