10305-38-1 Usage
Description
3-(Hexyloxy)-1,2-propanediol, also known as 1-O-Hexylglycerol, is a synthetic organic compound with a unique molecular structure that features a propanediol backbone with a hexyloxy group attached. 3-(Hexyloxy)-1,2-propanediol possesses properties that make it suitable for various applications across different industries due to its solubility, low toxicity, and ability to enhance permeability.
Uses
Used in Pharmaceutical Industry:
3-(Hexyloxy)-1,2-propanediol is used as a green solvo-surfactant for improving the solubility and bioavailability of drugs. Its surfactant properties allow it to reduce the surface tension between liquids, making it easier to formulate and administer medications.
Used in Anticancer Applications:
In the field of oncology, 3-(Hexyloxy)-1,2-propanediol is used to enhance the blood-brain barrier permeability for cytostatic and antibiotic agents in rats. This property is crucial for the treatment of brain tumors and other central nervous system-related conditions, as it allows for better drug delivery and increased therapeutic efficacy.
Used in Drug Delivery Systems:
3-(Hexyloxy)-1,2-propanediol can also be employed in the development of novel drug delivery systems, particularly for applications where enhanced permeability is required. Its ability to improve the blood-brain barrier permeability makes it a valuable component in the design of targeted drug delivery systems, potentially leading to more effective treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 10305-38-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,0 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10305-38:
(7*1)+(6*0)+(5*3)+(4*0)+(3*5)+(2*3)+(1*8)=51
51 % 10 = 1
So 10305-38-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H20O3/c1-2-3-4-5-6-12-9(7-10)8-11/h9-11H,2-8H2,1H3
