103204-34-8 Usage
General Description
3-(2-Carbamoyl-phenoxy)-propionic acid is a type of chemical compound that falls into the category of organic compounds known as phenylpropenes. It is a relatively complex molecule with the formula C10H11NO4. 3-(2-Carbamoyl-phenoxy)-propionic acid consists of a phenyl group (a ring of 6 carbon atoms) linked to a propene (a 3-carbon chain) through an oxygen atom. It also possesses carboxyl groups (COOH) and a carbamoyl group (NH2CO), which contributes to its overall reactivity. While there is not plenty of information specifically about this compound, given its structure, one may presume that it could be used in various chemical reactions and could also possibly be a metabolic by-product or intermediate. However, more in-depth research would be required to determine its exact properties, uses, and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 103204-34-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,2,0 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 103204-34:
(8*1)+(7*0)+(6*3)+(5*2)+(4*0)+(3*4)+(2*3)+(1*4)=58
58 % 10 = 8
So 103204-34-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO4/c11-10(14)7-3-1-2-4-8(7)15-6-5-9(12)13/h1-4H,5-6H2,(H2,11,14)(H,12,13)
