103213-38-3 Usage
General Description
H-GLY-LEU-PHE-OH is a tetrapeptide containing the amino acids glycine (Gly), leucine (Leu), and phenylalanine (Phe). These amino acids are essential for protein synthesis and play important roles in various biological processes. Glycine is the simplest amino acid and is involved in the synthesis of nucleic acids, bile acids, and other important molecules. Leucine is a branched-chain amino acid that plays a key role in protein synthesis and energy production. Phenylalanine is an aromatic amino acid that is important for the production of neurotransmitters and signaling molecules in the brain. The tetrapeptide H-GLY-LEU-PHE-OH may have potential applications in research, pharmaceuticals, and biotechnology due to its biological significance and potential therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 103213-38-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,2,1 and 3 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 103213-38:
(8*1)+(7*0)+(6*3)+(5*2)+(4*1)+(3*3)+(2*3)+(1*8)=63
63 % 10 = 3
So 103213-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H25N3O4/c1-11(2)8-13(19-15(21)10-18)16(22)20-14(17(23)24)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,18H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)
