103765-03-3 Usage
Description
(R)-(-)-2-AMINOBUTANAMIDE HYDROCHLORIDE, 97% is a chemical compound with the molecular formula C4H10N2O·HCl. It is a white crystalline solid and is commonly used as a reagent in the synthesis of various pharmaceutical compounds. (R)-(-)-2-AMINOBUTANAMIDE HYDROCHLORIDE, 97% is characterized by its high purity (97%) and is essential in the development of new drugs with potential therapeutic applications.
Uses
Used in Pharmaceutical Industry:
(R)-(-)-2-AMINOBUTANAMIDE HYDROCHLORIDE, 97% is used as a reagent for the synthesis of a new class of 2-[(arylalkyl)amino]alkanamide derivatives. These derivatives exhibit anticonvulsant activity, making them valuable in the development of treatments for epilepsy and other seizure disorders.
The compound plays a crucial role in the pharmaceutical industry as it aids in the creation of novel anticonvulsant drugs. By providing a starting material for the synthesis of these derivatives, (R)-(-)-2-AMINOBUTANAMIDE HYDROCHLORIDE, 97% contributes to the advancement of medical research and the development of more effective treatments for patients suffering from seizure-related conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 103765-03-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,6 and 5 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 103765-03:
(8*1)+(7*0)+(6*3)+(5*7)+(4*6)+(3*5)+(2*0)+(1*3)=103
103 % 10 = 3
So 103765-03-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H10N2O.ClH/c1-2-3(5)4(6)7;/h3H,2,5H2,1H3,(H2,6,7);1H/t3-;/m1./s1
