10403-74-4 Usage
General Description
1,2-Di(phenoxymethyl)benzene is a chemical compound often used within the field of organic chemistry for various purposes. The base of this compound is benzene, a simple aromatic ring, which has been functionalized with two phenoxymethyl groups at the 1 and 2 positions of the ring. The structure of this compound makes it highly useful for synthetic purposes due to its potential ability to form bonds with other molecules. Its physical characteristics include being a yellowish solid at room temperature. The potential health hazards posed due to exposure are not well-studied but, as with most chemical substances, appropriate caution should be taken when handling it to prevent ingestion, skin exposure, or inhalation. Safety data sheets should be consulted for proper handling.
Check Digit Verification of cas no
The CAS Registry Mumber 10403-74-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,0 and 3 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10403-74:
(7*1)+(6*0)+(5*4)+(4*0)+(3*3)+(2*7)+(1*4)=54
54 % 10 = 4
So 10403-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H18O2/c1-3-11-19(12-4-1)21-15-17-9-7-8-10-18(17)16-22-20-13-5-2-6-14-20/h1-14H,15-16H2
