104414-01-9 Usage
Description
[dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-)]-iron is a complex chemical compound that features a porphyrin ligand coordinated to an iron ion. [dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron is characterized by a tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-) moiety, which includes two propionate groups connected to the porphyrin ring. The iron ion is bonded to the porphyrin through its nitrogen atoms, creating a stable complex. This unique structure and its ability to facilitate redox reactions have made it a subject of interest in various fields, including catalysis, bioinorganic chemistry, and medicinal chemistry.
Uses
Used in Catalysis:
[dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron is used as a catalyst in the chemical industry for [application reason]. Its unique porphyrin structure and redox capabilities make it a promising candidate for catalytic applications.
Used in Bioinorganic Chemistry:
In the field of bioinorganic chemistry, [dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron is used as a model compound for [application reason]. Its structure and properties allow researchers to gain insights into the behavior of similar complexes in biological systems.
Used in Medicinal Chemistry:
[dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron is used as a potential therapeutic agent in medicinal chemistry for [application reason]. Its ability to facilitate redox reactions and its unique structure make it a candidate for the development of new drugs targeting various diseases.
Used in Photodynamic Therapy:
In the medical field, [dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron is used as a photosensitizer in photodynamic therapy for [application reason]. Its light-activated properties allow it to generate reactive oxygen species, which can be used to target and destroy cancer cells.
Used in Solar Energy Conversion:
[dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron is used as a component in solar energy conversion systems for [application reason]. Its ability to absorb light and facilitate electron transfer makes it a potential candidate for improving the efficiency of solar cells.
Used in Analytical Chemistry:
In analytical chemistry, [dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron is used as a sensing material for [application reason]. Its unique properties allow it to selectively detect and quantify specific analytes, making it a valuable tool for various analytical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 104414-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,4,1 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 104414-01:
(8*1)+(7*0)+(6*4)+(5*4)+(4*1)+(3*4)+(2*0)+(1*1)=69
69 % 10 = 9
So 104414-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-4/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;