106-03-6 Usage
General Description
Nonanedioic acid,1,9-bis(6-methylheptyl) ester is a chemical compound commonly known as di(isodecyl) phthalate (DIDP). It is a colorless, oily liquid with a mild odor, typically used as a plasticizer in the production of various polyvinyl chloride (PVC) products. DIDP is also used as a lubricant and as a component in the manufacturing of adhesives, inks, and sealants. It is known for its high thermal stability and resistance to abrasion, making it a valuable chemical in the production of durable and long-lasting materials. Furthermore, DIDP has low volatility and is considered to be relatively non-toxic, making it suitable for use in consumer products such as toys, food packaging, and medical devices. However, like other phthalates, there is some concern about its potential effects on human health, particularly its possible endocrine-disrupting properties.
Check Digit Verification of cas no
The CAS Registry Mumber 106-03-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 106-03:
(5*1)+(4*0)+(3*6)+(2*0)+(1*3)=26
26 % 10 = 6
So 106-03-6 is a valid CAS Registry Number.
InChI:InChI=1/C25H48O4/c1-22(2)16-10-8-14-20-28-24(26)18-12-6-5-7-13-19-25(27)29-21-15-9-11-17-23(3)4/h22-23H,5-21H2,1-4H3