1073-34-3 Usage
Description
4-chloro-3-methyl-1-oxido-pyridine is an organic compound with the chemical formula C6H5ClN2O. It is a derivative of pyridine, featuring a chlorine atom at the 4th position, a methyl group at the 3rd position, and an oxido group at the 1st position. 4-chloro-3-methyl-1-oxido-pyridine is known for its potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
4-chloro-3-methyl-1-oxido-pyridine is used as a nicotinamide analogue for its role as a neoplasm inhibitor. As a nicotinamide analogue, it interferes with the normal functioning of nicotinamide, which is a precursor to NAD+ and NADP+, essential coenzymes in cellular metabolism. By inhibiting neoplasms, this compound can potentially be used in the development of anti-cancer drugs, targeting the growth and proliferation of cancer cells.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-chloro-3-methyl-1-oxido-pyridine can be utilized as a building block or intermediate for the synthesis of various complex organic molecules. Its unique structure allows for further functionalization and modification, making it a valuable compound in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Research and Development:
4-chloro-3-methyl-1-oxido-pyridine can also be employed in research and development for studying the effects of structural modifications on the biological activity of pyridine derivatives. 4-chloro-3-methyl-1-oxido-pyridine can serve as a model for understanding the relationship between chemical structure and biological function, which is crucial in the design of new drugs and therapeutic agents.
Synthesis Reference(s)
Journal of the American Chemical Society, 78, p. 214, 1956 DOI: 10.1021/ja01582a059
Check Digit Verification of cas no
The CAS Registry Mumber 1073-34-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,7 and 3 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1073-34:
(6*1)+(5*0)+(4*7)+(3*3)+(2*3)+(1*4)=53
53 % 10 = 3
So 1073-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H6ClNO/c1-5-4-8(9)3-2-6(5)7/h2-4H,1H3
