108749-15-1 Usage
General Description
3-Acetamido-5-carboxybenzenboronic acid 98 is a chemical compound primarily used in the field of organic chemistry and pharmaceutical research. It is a boronic acid derivative with an acetamido and carboxy functional group attached to a benzene ring. This particular compound is commonly used as a reagent in the synthesis of various pharmaceuticals and biologically active molecules. It plays a crucial role in the formation of carbon-carbon and carbon-oxygen bonds within organic molecules, making it an important building block in drug discovery and development. Additionally, it is known for its ability to form stable complexes with other molecules, making it useful in the study and treatment of diseases such as cancer and diabetes. Overall, 3-acetamido-5-carboxybenzeneboronic acid 98 is a valuable tool for researchers in the pharmaceutical industry and academic institutions focusing on drug discovery and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 108749-15-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,7,4 and 9 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 108749-15:
(8*1)+(7*0)+(6*8)+(5*7)+(4*4)+(3*9)+(2*1)+(1*5)=141
141 % 10 = 1
So 108749-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BNO5/c1-5(12)11-8-3-6(9(13)14)2-7(4-8)10(15)16/h2-4,15-16H,1H3,(H,11,12)(H,13,14)
108749-15-1Relevant articles and documents
Synthesis and evaluation of 3-(dihydroxyboryl)benzoic acids as D,D-carboxypeptidase R39 inhibitors
Inglis, Steven R.,Zervosen, Astrid,Woon, Esther C. Y.,Gerards, Thomas,Teller, Nathalie,Fischer, Delphine S.,Luxen, André,Schofield, Christopher J.
supporting information; experimental part, p. 6097 - 6106 (2010/03/24)
Penicillin binding proteins (PBPs) catalyze steps in the biosynthesis of bacterial cell walls and are the targets for the β-lactam antibiotics. Non-β-lactam based antibiotics that target PBPs are of interest because bacteria have evolved resistance to the
