108983-83-1 Usage
Description
4-(DIPHENYLMETHYL)-1-PIPERAZINEETHANOL DIHYDROCHLORIDE, also known as 4-Benzhydryl-1-piperazineethanol Dihydrochloride, is a chemical compound with a molecular structure that features a diphenylmethyl group attached to a piperazine ring. 4-(DIPHENYLMETHYL)-1-PIPERAZINEETHANOL DIHYDROCHLORIDE is characterized by its ability to form various pharmaceutical compounds and has potential applications in the medical field due to its histamine antagonist properties.
Uses
Used in Pharmaceutical Industry:
4-(DIPHENYLMETHYL)-1-PIPERAZINEETHANOL DIHYDROCHLORIDE is used as a building block for the preparation of various pharmaceutical compounds. Its primary application is in the synthesis of 25 unsymmetrical 1,4-disubstituted piperazines, which serve as histamine antagonists. These histamine antagonists are crucial in the development of medications targeting conditions such as allergies, asthma, and other histamine-related disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 108983-83-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,9,8 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 108983-83:
(8*1)+(7*0)+(6*8)+(5*9)+(4*8)+(3*3)+(2*8)+(1*3)=161
161 % 10 = 1
So 108983-83-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H24N2O.2ClH/c22-16-15-20-11-13-21(14-12-20)19(17-7-3-1-4-8-17)18-9-5-2-6-10-18;;/h1-10,19,22H,11-16H2;2*1H
