110859-69-3 Usage
Description
4-METHYL-2-METHYLAMINO-THIAZOLE-5-CARBOXYLIC ACID is a chemical compound with the molecular formula C6H8N2O2S, belonging to the thiazole family. It features a methylamino group, a carboxylic acid group, and a methyl group, which contribute to its diverse applications in various industries.
Uses
Used in Pharmaceutical Industry:
4-METHYL-2-METHYLAMINO-THIAZOLE-5-CARBOXYLIC ACID is used as an intermediate in the synthesis of drugs for various medical conditions. Its thiazole ring is known to exhibit biological activity, making it a promising candidate for the development of new pharmaceuticals.
Used in Agrochemical Industry:
In the agrochemical sector, 4-METHYL-2-METHYLAMINO-THIAZOLE-5-CARBOXYLIC ACID is utilized as a building block for the creation of agrochemicals, such as pesticides and herbicides. Its unique chemical structure allows for the development of effective and targeted agrochemicals.
Used in Chemical Industry for Materials Synthesis:
4-METHYL-2-METHYLAMINO-THIAZOLE-5-CARBOXYLIC ACID is employed as a key component in the synthesis of various materials in the chemical industry. Its versatile chemical properties enable the production of materials with specific characteristics, such as high thermal stability or unique electronic properties.
Overall, 4-Methyl-2-methylamino-thiazole-5-carboxylic acid is a versatile chemical with wide-ranging applications in research and industry, particularly in the development of pharmaceuticals, agrochemicals, and advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 110859-69-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,8,5 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 110859-69:
(8*1)+(7*1)+(6*0)+(5*8)+(4*5)+(3*9)+(2*6)+(1*9)=123
123 % 10 = 3
So 110859-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2S/c1-3-4(5(9)10)11-6(7-2)8-3/h1-2H3,(H,7,8)(H,9,10)
110859-69-3Relevant articles and documents
Thiazolecarboxylic acid derivatives. 1. N-substituted 2-amino-4- methylthiazole-5-carboxylic acid derivatives
Dovlatyan,Eliazyan,Pivazyan,Kazaryan,Engoyan
, p. 84 - 89 (2004)
Acylation of the ethyl ester and anilide of 2-amino-4-methylthiazole-5- carboxylic acid gave 2-acetyl(arylsulfonyl)amino derivatives. Methylation of acetylaminothiazole and subsequent deacetylation gave 2-methylamino-4- methylthiazole-5-carboxylic acid, w
