110960-73-1 Usage
Description
ETHYL-4-METHYL PYRIMIDINE-5-CARBOXYLATE is an organic compound that serves as a crucial intermediate in the synthesis of various chemical compounds, particularly those with potential pharmaceutical applications. It is characterized by its molecular structure, which includes a pyrimidine ring with a carboxylate group and an ethyl ester, making it a versatile building block in the development of new drugs and chemical products.
Uses
Used in Pharmaceutical Industry:
ETHYL-4-METHYL PYRIMIDINE-5-CARBOXYLATE is used as a reagent for the synthesis of Pyrazole (P842195) derivatives. These compounds have demonstrated the ability to treat patients with lung cancer, offering a potential therapeutic option for this type of cancer.
Used in Chemical Synthesis:
ETHYL-4-METHYL PYRIMIDINE-5-CARBOXYLATE is also used as a key component in the synthesis of other chemical compounds, particularly those with potential applications in various industries. Its unique molecular structure allows for the creation of a wide range of products, making it a valuable asset in the field of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 110960-73-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,9,6 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 110960-73:
(8*1)+(7*1)+(6*0)+(5*9)+(4*6)+(3*0)+(2*7)+(1*3)=101
101 % 10 = 1
So 110960-73-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-3-12-8(11)7-4-9-5-10-6(7)2/h4-5H,3H2,1-2H3
