1139-11-3 Usage
General Description
3-AMINO-5-ETHYL-5-PHENYLIMIDAZOLIDINE-2,4-DIONE is a chemical compound with the molecular formula C11H15N3O2. It is a heterocyclic compound with a five-membered ring structure containing nitrogen and oxygen atoms. 3-AMINO-5-ETHYL-5-PHENYLIMIDAZOLIDINE-2,4-DIONE is a derivative of imidazolidine-2,4-dione and has a substituted amino group and an ethyl and phenyl group attached to the ring. It is used in organic synthesis and pharmaceutical research as a building block for creating bioactive compounds and potential drug candidates. 3-AMINO-5-ETHYL-5-PHENYLIMIDAZOLIDINE-2,4-DIONE may also have potential applications in the field of medicinal chemistry due to its structural and pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 1139-11-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,3 and 9 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1139-11:
(6*1)+(5*1)+(4*3)+(3*9)+(2*1)+(1*1)=53
53 % 10 = 3
So 1139-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3O2/c1-2-11(8-6-4-3-5-7-8)9(15)14(12)10(16)13-11/h3-7H,2,12H2,1H3,(H,13,16)/t11-/m0/s1